CAS 58149-93-2 appears in our catalog under these names: 1-(7-Chloronaphthalen-1-yl)ethanone, 97%, 1-(7-Chloronaphthalen-1-yl)ethanone. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
1-(7-chloronaphthalen-1-yl)ethanone (CAS 58149-93-2) is a chemical compound with the molecular formula C12H9ClO and a molecular weight of 204.65 g/mol. IUPAC name: 1-(7-chloronaphthalen-1-yl)ethanone. InChIKey: ZHGFSRBCIFURGS-UHFFFAOYSA-N.
| Molecular formula | C12H9ClO |
|---|---|
| Molecular weight | 204.65 g/mol |
| IUPAC name | 1-(7-chloronaphthalen-1-yl)ethanone |
| InChIKey | ZHGFSRBCIFURGS-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=CC2=C1C=C(C=C2)Cl |
Computed by PubChem (NCBI)