Products 582-80-9
CAS 582-80-9 appears in our catalog under these names: 4-(Benzoylamino)benzoic acid, 98%, p-(Benzoylamino)benzoic Acid, 4–Benzamidobenzoic acid, 4-Benzamidobenzoic acid 95%, 4-Benzamidobenzoic acid, 95%, 95%. Offered by: Combi-blocks, TRC, GLPBio, Ambeed, Chemat. Available pack sizes: 10g, 5g, 1g, 25g, 100g, 250mg.
4-benzamidobenzoic acid (CAS 582-80-9) is a chemical compound with the molecular formula C14H11NO3 and a molecular weight of 241.24 g/mol. IUPAC name: 4-benzamidobenzoic acid. InChIKey: UZKKMWJMAJGMPF-UHFFFAOYSA-N.
| Molecular formula | C14H11NO3 |
|---|---|
| Molecular weight | 241.24 g/mol |
| IUPAC name | 4-benzamidobenzoic acid |
| InChIKey | UZKKMWJMAJGMPF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)NC2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)