CAS 58236-91-2 appears in our catalog under these names: 3-Chloro-4-(prop-2-en-1-yloxy)benzaldehyde, 95%, 3-chloro-4-(prop-2-en-1-yloxy)benzaldehyde. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 2,5g.
3-chloro-4-prop-2-enoxybenzaldehyde (CAS 58236-91-2) is a chemical compound with the molecular formula C10H9ClO2 and a molecular weight of 196.63 g/mol. IUPAC name: 3-chloro-4-prop-2-enoxybenzaldehyde. InChIKey: KMFXGBKTGDWRTF-UHFFFAOYSA-N.
| Molecular formula | C10H9ClO2 |
|---|---|
| Molecular weight | 196.63 g/mol |
| IUPAC name | 3-chloro-4-prop-2-enoxybenzaldehyde |
| InChIKey | KMFXGBKTGDWRTF-UHFFFAOYSA-N |
| SMILES | C=CCOC1=C(C=C(C=C1)C=O)Cl |
Computed by PubChem (NCBI)