CAS 58585-25-4 appears in our catalog under these names: rac-5'-Hydroxy Thalidomide, 3-(1-Hydroxy-3-oxo-2,3-dihydro-1H-isoindol-2-yl)piperidine-2,6-dione. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 0,5g, 50mg.
3-(1-hydroxy-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione (CAS 58585-25-4) is a chemical compound with the molecular formula C13H12N2O4 and a molecular weight of 260.24 g/mol. IUPAC name: 3-(1-hydroxy-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione. InChIKey: ZCJDRBLJNPFHHK-UHFFFAOYSA-N.
| Molecular formula | C13H12N2O4 |
|---|---|
| Molecular weight | 260.24 g/mol |
| IUPAC name | 3-(1-hydroxy-3-oxo-1H-isoindol-2-yl)piperidine-2,6-dione |
| InChIKey | ZCJDRBLJNPFHHK-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2C(C3=CC=CC=C3C2=O)O |
Computed by PubChem (NCBI)