CAS 58621-51-5 appears in our catalog under these names: 5-Acetyl-2,3-dihydro-2-methylbenzofuran, 95%, 1-(2-Methyl-2,3-dihydro-1-benzofuran-5-yl)ethan-1-one. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 10g, 250mg, 1g, 0,5g.
1-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)ethanone (CAS 58621-51-5) is a chemical compound with the molecular formula C11H12O2 and a molecular weight of 176.21 g/mol. IUPAC name: 1-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)ethanone. InChIKey: MORJCRDAGOARLY-UHFFFAOYSA-N.
| Molecular formula | C11H12O2 |
|---|---|
| Molecular weight | 176.21 g/mol |
| IUPAC name | 1-(2-methyl-2,3-dihydro-1-benzofuran-5-yl)ethanone |
| InChIKey | MORJCRDAGOARLY-UHFFFAOYSA-N |
| SMILES | CC1CC2=C(O1)C=CC(=C2)C(=O)C |
Computed by PubChem (NCBI)