Products 58651-55-1
CAS 58651-55-1 is the registry number for Ethyl 3-Ethoxy-2-Nitroacrylate, >95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
Ethyl (Z)-3-ethoxy-2-nitroprop-2-enoate (CAS 58651-55-1) is a chemical compound with the molecular formula C7H11NO5 and a molecular weight of 189.17 g/mol. IUPAC name: ethyl (Z)-3-ethoxy-2-nitroprop-2-enoate. InChIKey: NCRBAZRGVXAEOT-WAYWQWQTSA-N.
| Molecular formula | C7H11NO5 |
|---|---|
| Molecular weight | 189.17 g/mol |
| IUPAC name | ethyl (Z)-3-ethoxy-2-nitroprop-2-enoate |
| InChIKey | NCRBAZRGVXAEOT-WAYWQWQTSA-N |
| SMILES | CCO/C=C(/C(=O)OCC)\[N+](=O)[O-] |
Computed by PubChem (NCBI)