CAS 587-54-2 appears in our catalog under these names: 3-(Benzoylamino)benzoic acid, 98%, 3–Benzamidobenzoic acid, 3-Benzamidobenzoic acid 98%. Offered by: Combi-blocks, GLPBio, Ambeed. Available pack sizes: 1g, 5g, 25g, 100mg, 250mg.
3-benzamidobenzoic acid (CAS 587-54-2) is a chemical compound with the molecular formula C14H11NO3 and a molecular weight of 241.24 g/mol. IUPAC name: 3-benzamidobenzoic acid. InChIKey: WXTOAZQBWHSIQN-UHFFFAOYSA-N.
| Molecular formula | C14H11NO3 |
|---|---|
| Molecular weight | 241.24 g/mol |
| IUPAC name | 3-benzamidobenzoic acid |
| InChIKey | WXTOAZQBWHSIQN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)NC2=CC=CC(=C2)C(=O)O |
Computed by PubChem (NCBI)