CAS 58743-75-2 appears in our catalog under these names: 4–Cyano–4'–ethylbiphenyl, 4-Cyano-4'-ethylbiphenyl, >98.0%(GC), 4'-Ethyl-[1,1'-biphenyl]-4-carbonitrile 98%, 4-Cyano-4'-ethylbiphenyl, 98%. Offered by: GLPBio, TCI, Ambeed, Fluorochem. Available pack sizes: 100g, 25g, 5g, 1g.
4-(4-ethylphenyl)benzonitrile (CAS 58743-75-2) is a chemical compound with the molecular formula C15H13N and a molecular weight of 207.27 g/mol. IUPAC name: 4-(4-ethylphenyl)benzonitrile. InChIKey: DLLIPJSMDJCZRF-UHFFFAOYSA-N.
| Molecular formula | C15H13N |
|---|---|
| Molecular weight | 207.27 g/mol |
| IUPAC name | 4-(4-ethylphenyl)benzonitrile |
| InChIKey | DLLIPJSMDJCZRF-UHFFFAOYSA-N |
| SMILES | CCC1=CC=C(C=C1)C2=CC=C(C=C2)C#N |
Computed by PubChem (NCBI)