Products 58868-18-1
CAS 58868-18-1 is the registry number for 4-Chloro-5,8-dimethoxy-2-methylquinoline, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
4-chloro-5,8-dimethoxy-2-methylquinoline (CAS 58868-18-1) is a chemical compound with the molecular formula C12H12ClNO2 and a molecular weight of 237.68 g/mol. IUPAC name: 4-chloro-5,8-dimethoxy-2-methylquinoline. InChIKey: NXXMZEGWBOBDHM-UHFFFAOYSA-N.
| Molecular formula | C12H12ClNO2 |
|---|---|
| Molecular weight | 237.68 g/mol |
| IUPAC name | 4-chloro-5,8-dimethoxy-2-methylquinoline |
| InChIKey | NXXMZEGWBOBDHM-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C=CC(=C2C(=C1)Cl)OC)OC |
Computed by PubChem (NCBI)