CAS 59-35-8 is the registry number for 4,6-Dimethyl-2-(5-nitro-2-furanyl)pyrimidine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg.
4,6-dimethyl-2-(5-nitrofuran-2-yl)pyrimidine (CAS 59-35-8) is a chemical compound with the molecular formula C10H9N3O3 and a molecular weight of 219.20 g/mol. IUPAC name: 4,6-dimethyl-2-(5-nitrofuran-2-yl)pyrimidine. InChIKey: RYBISXUKVTYYNN-UHFFFAOYSA-N.
| Molecular formula | C10H9N3O3 |
|---|---|
| Molecular weight | 219.20 g/mol |
| IUPAC name | 4,6-dimethyl-2-(5-nitrofuran-2-yl)pyrimidine |
| InChIKey | RYBISXUKVTYYNN-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=N1)C2=CC=C(O2)[N+](=O)[O-])C |
Computed by PubChem (NCBI)