CAS 5900-56-1 appears in our catalog under these names: 2-Acetamido-4-chlorobenzoic acid, 98%, 2-Acetamido-4-chlorobenzoic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 10g, 25g, 5g, 1g.
2-acetamido-4-chlorobenzoic acid (CAS 5900-56-1) is a chemical compound with the molecular formula C9H8ClNO3 and a molecular weight of 213.62 g/mol. IUPAC name: 2-acetamido-4-chlorobenzoic acid. InChIKey: SONOHJNKSOBNKY-UHFFFAOYSA-N.
| Molecular formula | C9H8ClNO3 |
|---|---|
| Molecular weight | 213.62 g/mol |
| IUPAC name | 2-acetamido-4-chlorobenzoic acid |
| InChIKey | SONOHJNKSOBNKY-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=C(C=CC(=C1)Cl)C(=O)O |
Computed by PubChem (NCBI)