Products 590376-72-0
CAS 590376-72-0 is the registry number for 2-(4-Chloro-2-formylphenoxy)acetamide. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-(4-chloro-2-formylphenoxy)acetamide (CAS 590376-72-0) is a chemical compound with the molecular formula C9H8ClNO3 and a molecular weight of 213.62 g/mol. IUPAC name: 2-(4-chloro-2-formylphenoxy)acetamide. InChIKey: JHDDXYAHRSNFQX-UHFFFAOYSA-N.
| Molecular formula | C9H8ClNO3 |
|---|---|
| Molecular weight | 213.62 g/mol |
| IUPAC name | 2-(4-chloro-2-formylphenoxy)acetamide |
| InChIKey | JHDDXYAHRSNFQX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)C=O)OCC(=O)N |
Computed by PubChem (NCBI)