CAS 5910-25-8 appears in our catalog under these names: 3-Phenyl-2,4-pentanedione, 95%, 3–Phenyl–2,4–pentanedione, 3-Phenyl-2,4-pentanedione, >98.0%(GC), 3-Phenylpentane-2,4-dione 98%, 3-Phenylpentane-2,4-dione, 98%, 98%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 1g, 10g, 25g, 5g, 250mg, 100mg.
3-phenylpentane-2,4-dione (CAS 5910-25-8) is a chemical compound with the molecular formula C11H12O2 and a molecular weight of 176.21 g/mol. IUPAC name: 3-phenylpentane-2,4-dione. InChIKey: YIWTXSVNRCWBAC-UHFFFAOYSA-N.
| Molecular formula | C11H12O2 |
|---|---|
| Molecular weight | 176.21 g/mol |
| IUPAC name | 3-phenylpentane-2,4-dione |
| InChIKey | YIWTXSVNRCWBAC-UHFFFAOYSA-N |
| SMILES | CC(=O)C(C1=CC=CC=C1)C(=O)C |
Computed by PubChem (NCBI)