CAS 59269-93-1 appears in our catalog under these names: 3-Hydroxy-2,2-dimethyl-1-indanone, >95%, >95%, 3-Hydroxy-2,2-dimethyl-2,3-dihydro-1H-inden-1-one, >95%. Offered by: Chemat, Fluorochem. Available pack sizes: 250mg.
3-hydroxy-2,2-dimethyl-3H-inden-1-one (CAS 59269-93-1) is a chemical compound with the molecular formula C11H12O2 and a molecular weight of 176.21 g/mol. IUPAC name: 3-hydroxy-2,2-dimethyl-3H-inden-1-one. InChIKey: YATVHPCKCBERKE-UHFFFAOYSA-N.
| Molecular formula | C11H12O2 |
|---|---|
| Molecular weight | 176.21 g/mol |
| IUPAC name | 3-hydroxy-2,2-dimethyl-3H-inden-1-one |
| InChIKey | YATVHPCKCBERKE-UHFFFAOYSA-N |
| SMILES | CC1(C(C2=CC=CC=C2C1=O)O)C |
Computed by PubChem (NCBI)