CAS 59366-89-1 appears in our catalog under these names: N-Formyl-d-phenylalanine, 95%, N–Formyl–D–phenylalanine, N-Formyl-D-phenylalanine, >98.0%(T)(HPLC), (R)-2-Formamido-3-phenylpropanoic acid, 98.0%, 98.0%, N-Formyl-D-phenylalanine, 98%(T). Offered by: Combi-blocks, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 2g, 500mg.
(2R)-2-formamido-3-phenylpropanoic acid (CAS 59366-89-1) is a chemical compound with the molecular formula C10H11NO3 and a molecular weight of 193.20 g/mol. IUPAC name: (2R)-2-formamido-3-phenylpropanoic acid. InChIKey: NSTPXGARCQOSAU-SECBINFHSA-N.
| Molecular formula | C10H11NO3 |
|---|---|
| Molecular weight | 193.20 g/mol |
| IUPAC name | (2R)-2-formamido-3-phenylpropanoic acid |
| InChIKey | NSTPXGARCQOSAU-SECBINFHSA-N |
| SMILES | C1=CC=C(C=C1)C[C@H](C(=O)O)NC=O |
Computed by PubChem (NCBI)