Products 59490-97-0
CAS 59490-97-0 is the registry number for N-(2-Carbamoylphenyl)furan-2-carboxamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(2-carbamoylphenyl)furan-2-carboxamide (CAS 59490-97-0) is a chemical compound with the molecular formula C12H10N2O3 and a molecular weight of 230.22 g/mol. IUPAC name: N-(2-carbamoylphenyl)furan-2-carboxamide. InChIKey: CMSLCRUYTJMHKS-UHFFFAOYSA-N.
| Molecular formula | C12H10N2O3 |
|---|---|
| Molecular weight | 230.22 g/mol |
| IUPAC name | N-(2-carbamoylphenyl)furan-2-carboxamide |
| InChIKey | CMSLCRUYTJMHKS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)N)NC(=O)C2=CC=CO2 |
Computed by PubChem (NCBI)