CAS 59666-16-9 is the registry number for 2,7-Dichloro-4-methylquinoline, 97%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
2,7-dichloro-4-methylquinoline (CAS 59666-16-9) is a chemical compound with the molecular formula C10H7Cl2N and a molecular weight of 212.07 g/mol. IUPAC name: 2,7-dichloro-4-methylquinoline. InChIKey: FTONSAARTKYOAV-UHFFFAOYSA-N.
| Molecular formula | C10H7Cl2N |
|---|---|
| Molecular weight | 212.07 g/mol |
| IUPAC name | 2,7-dichloro-4-methylquinoline |
| InChIKey | FTONSAARTKYOAV-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC2=C1C=CC(=C2)Cl)Cl |
Computed by PubChem (NCBI)