CAS 5973-28-4 appears in our catalog under these names: 7-Chloro-1-methyl-3,4-dihydro-1H-benzo[e][1,4]diazepine-2,5-dione, 98%, 98%, 7-Chloro-1-methyl-3,4-dihydro-1H-benzo[e][1,4]diazepine-2,5-dione, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
7-chloro-1-methyl-3,4-dihydro-1,4-benzodiazepine-2,5-dione (CAS 5973-28-4) is a chemical compound with the molecular formula C10H9ClN2O2 and a molecular weight of 224.64 g/mol. IUPAC name: 7-chloro-1-methyl-3,4-dihydro-1,4-benzodiazepine-2,5-dione. InChIKey: VOQUEWRCTHTSSR-UHFFFAOYSA-N.
| Molecular formula | C10H9ClN2O2 |
|---|---|
| Molecular weight | 224.64 g/mol |
| IUPAC name | 7-chloro-1-methyl-3,4-dihydro-1,4-benzodiazepine-2,5-dione |
| InChIKey | VOQUEWRCTHTSSR-UHFFFAOYSA-N |
| SMILES | CN1C(=O)CNC(=O)C2=C1C=CC(=C2)Cl |
Computed by PubChem (NCBI)