Products 5973-29-5

CAS 5973-29-5 appears in our catalog under these names: Flumazenil Impurity 10, Flumazenil Impurity 1. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

7-chloro-4-methyl-1,3-dihydro-1,4-benzodiazepine-2,5-dione (CAS 5973-29-5) is a chemical compound with the molecular formula C10H9ClN2O2 and a molecular weight of 224.64 g/mol. IUPAC name: 7-chloro-4-methyl-1,3-dihydro-1,4-benzodiazepine-2,5-dione. InChIKey: FNTLWYZULYTGHD-UHFFFAOYSA-N.

Identity
Molecular formulaC10H9ClN2O2
Molecular weight224.64 g/mol
IUPAC name7-chloro-4-methyl-1,3-dihydro-1,4-benzodiazepine-2,5-dione
InChIKeyFNTLWYZULYTGHD-UHFFFAOYSA-N
SMILESCN1CC(=O)NC2=C(C1=O)C=C(C=C2)Cl

Computed by PubChem (NCBI)