CAS 5973-29-5 appears in our catalog under these names: Flumazenil Impurity 10, Flumazenil Impurity 1. Offered by: Chemat Brand. Available pack sizes: on request.
7-chloro-4-methyl-1,3-dihydro-1,4-benzodiazepine-2,5-dione (CAS 5973-29-5) is a chemical compound with the molecular formula C10H9ClN2O2 and a molecular weight of 224.64 g/mol. IUPAC name: 7-chloro-4-methyl-1,3-dihydro-1,4-benzodiazepine-2,5-dione. InChIKey: FNTLWYZULYTGHD-UHFFFAOYSA-N.
| Molecular formula | C10H9ClN2O2 |
|---|---|
| Molecular weight | 224.64 g/mol |
| IUPAC name | 7-chloro-4-methyl-1,3-dihydro-1,4-benzodiazepine-2,5-dione |
| InChIKey | FNTLWYZULYTGHD-UHFFFAOYSA-N |
| SMILES | CN1CC(=O)NC2=C(C1=O)C=C(C=C2)Cl |
Computed by PubChem (NCBI)