CAS 59871-14-6 is the registry number for 3-Chloro-4-(3-methoxyphenoxy)aniline. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
3-chloro-4-(3-methoxyphenoxy)aniline (CAS 59871-14-6) is a chemical compound with the molecular formula C13H12ClNO2 and a molecular weight of 249.69 g/mol. IUPAC name: 3-chloro-4-(3-methoxyphenoxy)aniline. InChIKey: ZKFZVCBUFBFPSJ-UHFFFAOYSA-N.
| Molecular formula | C13H12ClNO2 |
|---|---|
| Molecular weight | 249.69 g/mol |
| IUPAC name | 3-chloro-4-(3-methoxyphenoxy)aniline |
| InChIKey | ZKFZVCBUFBFPSJ-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC=C1)OC2=C(C=C(C=C2)N)Cl |
Computed by PubChem (NCBI)