Products 5999-20-2
CAS 5999-20-2 appears in our catalog under these names: 5,6-Dimethylisobenzofuran-1,3-dione, 98%, 98%, 4,5-Dimethyl-phthalic acid anhydride, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
5,6-dimethyl-2-benzofuran-1,3-dione (CAS 5999-20-2) is a chemical compound with the molecular formula C10H8O3 and a molecular weight of 176.17 g/mol. IUPAC name: 5,6-dimethyl-2-benzofuran-1,3-dione. InChIKey: CMQYISATYUYSAC-UHFFFAOYSA-N.
| Molecular formula | C10H8O3 |
|---|---|
| Molecular weight | 176.17 g/mol |
| IUPAC name | 5,6-dimethyl-2-benzofuran-1,3-dione |
| InChIKey | CMQYISATYUYSAC-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1C)C(=O)OC2=O |
Computed by PubChem (NCBI)
Synonyms:
5,6-Dimethyl-2-benzofuran-1,3-dione, 4,5-dimethyl-phthalic acid anhydride, 5,6-Dimethylisobenzofuran-1,3-dione, 4,5-dimethylphthalic anhydride, 1,3-Isobenzofurandione, 5,6-dimethyl-, 1, 5,6-dimethyl-, 5,6-Dimethyl-1,3-isobenzofurandione, 4,5-Dimethyl-phthalic acid anhydri, 4,5-Dimethylphthalic Acid Anhydride, 5,6-Dimethyl-2-benzofuran-1,3-dione #