CAS 60013-02-7 appears in our catalog under these names: Fenofibrate Impurity 9, Fenofibrate Impurity 18. Offered by: Chemat Brand. Available pack sizes: on request.
(3,4-dichlorophenyl)-(4-hydroxyphenyl)methanone (CAS 60013-02-7) is a chemical compound with the molecular formula C13H8Cl2O2 and a molecular weight of 267.10 g/mol. IUPAC name: (3,4-dichlorophenyl)-(4-hydroxyphenyl)methanone. InChIKey: OHPVWFWLSJHCPZ-UHFFFAOYSA-N.
| Molecular formula | C13H8Cl2O2 |
|---|---|
| Molecular weight | 267.10 g/mol |
| IUPAC name | (3,4-dichlorophenyl)-(4-hydroxyphenyl)methanone |
| InChIKey | OHPVWFWLSJHCPZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)C2=CC(=C(C=C2)Cl)Cl)O |
Computed by PubChem (NCBI)