CAS 6036-46-0 appears in our catalog under these names: 2-Ethoxy-6-nitroaniline, 95%, 2-Ethoxy-6-nitroaniline, 95%, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
2-ethoxy-6-nitroaniline (CAS 6036-46-0) is a chemical compound with the molecular formula C8H10N2O3 and a molecular weight of 182.18 g/mol. IUPAC name: 2-ethoxy-6-nitroaniline. InChIKey: WBAPTPZBKPFPPB-UHFFFAOYSA-N.
| Molecular formula | C8H10N2O3 |
|---|---|
| Molecular weight | 182.18 g/mol |
| IUPAC name | 2-ethoxy-6-nitroaniline |
| InChIKey | WBAPTPZBKPFPPB-UHFFFAOYSA-N |
| SMILES | CCOC1=CC=CC(=C1N)[N+](=O)[O-] |
Computed by PubChem (NCBI)