CAS 60418-64-6 is the registry number for Melatonin Methoxy-d3. Offered by: TRC, Biosynth. Available pack sizes: 25mg, 10mg, 5mg, 50mg.
N-[2-[5-(trideuteriomethoxy)-1H-indol-3-yl]ethyl]acetamide (CAS 60418-64-6) is a chemical compound with the molecular formula C13H16N2O2 and a molecular weight of 235.30 g/mol. IUPAC name: N-[2-[5-(trideuteriomethoxy)-1H-indol-3-yl]ethyl]acetamide. InChIKey: DRLFMBDRBRZALE-BMSJAHLVSA-N.
| Molecular formula | C13H16N2O2 |
|---|---|
| Molecular weight | 235.30 g/mol |
| IUPAC name | N-[2-[5-(trideuteriomethoxy)-1H-indol-3-yl]ethyl]acetamide |
| InChIKey | DRLFMBDRBRZALE-BMSJAHLVSA-N |
| SMILES | [2H]C([2H])([2H])OC1=CC2=C(C=C1)NC=C2CCNC(=O)C |
Computed by PubChem (NCBI)