Products 615251-68-8
CAS 615251-68-8 appears in our catalog under these names: Melatonin-d7, N-Acetyl-d3-5-methoxytryptamine-a,a,b,b-d4, 98 atom % D, min 98% Chemical Purity, Melatonin–d7, Melatonin-d7, 98.0%. Offered by: TRC, CDN, GLPBio, MedChemExpress. Available pack sizes: 10mg, 1mg, 5mg, 0,01g, 0,005g, 1 mg.
2,2,2-trideuterio-N-[1,1,2,2-tetradeuterio-2-(5-methoxy-1H-indol-3-yl)ethyl]acetamide (CAS 615251-68-8) is a chemical compound with the molecular formula C13H16N2O2 and a molecular weight of 239.32 g/mol. IUPAC name: 2,2,2-trideuterio-N-[1,1,2,2-tetradeuterio-2-(5-methoxy-1H-indol-3-yl)ethyl]acetamide. InChIKey: DRLFMBDRBRZALE-FJNYTKNASA-N.
| Molecular formula | C13H16N2O2 |
|---|---|
| Molecular weight | 239.32 g/mol |
| IUPAC name | 2,2,2-trideuterio-N-[1,1,2,2-tetradeuterio-2-(5-methoxy-1H-indol-3-yl)ethyl]acetamide |
| InChIKey | DRLFMBDRBRZALE-FJNYTKNASA-N |
| SMILES | [2H]C([2H])([2H])C(=O)NC([2H])([2H])C([2H])([2H])C1=CNC2=C1C=C(C=C2)OC |
Computed by PubChem (NCBI)