Products 605-70-9
CAS 605-70-9 appears in our catalog under these names: 1,4-Naphthalenedicarboxylic Acid, 1,4–Naphthalenedicarboxylic acid, Naphthalene-1,4-dicarboxylic acid, 98+% , 1,4-Naphthalenedicarboxylic Acid, >95.0%(GC)(T), Naphthalene-1,4-dicarboxylic acid 98%. Offered by: Chemat Brand, GLPBio, Thermo Scientific (Alfa Aesar), TCI, Ambeed. Available pack sizes: on request, 100g, 25g, 500g, 10g, 1000g, 5g, 1kg.
Naphthalene-1,4-dicarboxylic acid (CAS 605-70-9) is a chemical compound with the molecular formula C12H8O4 and a molecular weight of 216.19 g/mol. IUPAC name: naphthalene-1,4-dicarboxylic acid. InChIKey: ABMFBCRYHDZLRD-UHFFFAOYSA-N.
| Molecular formula | C12H8O4 |
|---|---|
| Molecular weight | 216.19 g/mol |
| IUPAC name | naphthalene-1,4-dicarboxylic acid |
| InChIKey | ABMFBCRYHDZLRD-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC=C2C(=O)O)C(=O)O |
Computed by PubChem (NCBI)