CAS 70749-06-3 appears in our catalog under these names: (1S,2S)-N1,N2-Dimethyl-1,2-diphenylethane-1,2-diamine, 97%, 97%, (1S,2S)-N1,N2-Dimethyl-1,2-diphenylethane-1,2-diamine, 95%. Offered by: Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 5g, 10g, 25g.
(1S,2S)-N,N'-dimethyl-1,2-diphenylethane-1,2-diamine (CAS 70749-06-3) is a chemical compound with the molecular formula C16H20N2 and a molecular weight of 240.34 g/mol. IUPAC name: (1S,2S)-N,N'-dimethyl-1,2-diphenylethane-1,2-diamine. InChIKey: BTHYVQUNQHWNLS-HOTGVXAUSA-N.
| Molecular formula | C16H20N2 |
|---|---|
| Molecular weight | 240.34 g/mol |
| IUPAC name | (1S,2S)-N,N'-dimethyl-1,2-diphenylethane-1,2-diamine |
| InChIKey | BTHYVQUNQHWNLS-HOTGVXAUSA-N |
| SMILES | CN[C@@H](C1=CC=CC=C1)[C@H](C2=CC=CC=C2)NC |
Computed by PubChem (NCBI)