CAS 60521-26-8 appears in our catalog under these names: 3–((1,1'–Biphenyl)–3–yl)acrylic acid, 3-([1,1'-Biphenyl]-3-yl)acrylic acid, 95%, 95%. Offered by: GLPBio, Chemat. Available pack sizes: 100mg, 250mg, 1g.
(E)-3-(3-phenylphenyl)prop-2-enoic acid (CAS 60521-26-8) is a chemical compound with the molecular formula C15H12O2 and a molecular weight of 224.25 g/mol. IUPAC name: (E)-3-(3-phenylphenyl)prop-2-enoic acid. InChIKey: QQQNPVHFBDPNNA-MDZDMXLPSA-N.
| Molecular formula | C15H12O2 |
|---|---|
| Molecular weight | 224.25 g/mol |
| IUPAC name | (E)-3-(3-phenylphenyl)prop-2-enoic acid |
| InChIKey | QQQNPVHFBDPNNA-MDZDMXLPSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=CC(=C2)/C=C/C(=O)O |
Computed by PubChem (NCBI)