CAS 60541-32-4 is the registry number for 1,3,5-Benzenetricarboxamide, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
Benzene-1,3,5-tricarboxamide (CAS 60541-32-4) is a chemical compound with the molecular formula C9H9N3O3 and a molecular weight of 207.19 g/mol. IUPAC name: benzene-1,3,5-tricarboxamide. InChIKey: WXWQVSOHWXJBDF-UHFFFAOYSA-N.
| Molecular formula | C9H9N3O3 |
|---|---|
| Molecular weight | 207.19 g/mol |
| IUPAC name | benzene-1,3,5-tricarboxamide |
| InChIKey | WXWQVSOHWXJBDF-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1C(=O)N)C(=O)N)C(=O)N |
Computed by PubChem (NCBI)