Products 60541-86-8
CAS 60541-86-8 is the registry number for Ethyl 3-amino-2,5-dichlorobenzoate, 97%. Offered by: Fluorochem, Chemat. Available pack sizes: 50mg, 100mg, 250mg, 500mg, 1g, 2.5g, 5g, 10g.
Ethyl 3-amino-2,5-dichlorobenzoate (CAS 60541-86-8) is a chemical compound with the molecular formula C9H9Cl2NO2 and a molecular weight of 234.08 g/mol. IUPAC name: ethyl 3-amino-2,5-dichlorobenzoate. InChIKey: MHMMVAMMASEGOB-UHFFFAOYSA-N.
| Molecular formula | C9H9Cl2NO2 |
|---|---|
| Molecular weight | 234.08 g/mol |
| IUPAC name | ethyl 3-amino-2,5-dichlorobenzoate |
| InChIKey | MHMMVAMMASEGOB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C(=CC(=C1)Cl)N)Cl |
Computed by PubChem (NCBI)