Products 605661-85-6
CAS 605661-85-6 appears in our catalog under these names: 4-Chloropyridine-2,3-dicarboxylic acid, 97%, 97%, 4-Chloropyridine-2,3-dicarboxylic acid, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
4-chloropyridine-2,3-dicarboxylic acid (CAS 605661-85-6) is a chemical compound with the molecular formula C7H4ClNO4 and a molecular weight of 201.56 g/mol. IUPAC name: 4-chloropyridine-2,3-dicarboxylic acid. InChIKey: ASZRIBNKXOGEDF-UHFFFAOYSA-N.
| Molecular formula | C7H4ClNO4 |
|---|---|
| Molecular weight | 201.56 g/mol |
| IUPAC name | 4-chloropyridine-2,3-dicarboxylic acid |
| InChIKey | ASZRIBNKXOGEDF-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C(=C1Cl)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)