Products 606097-80-7
CAS 606097-80-7 appears in our catalog under these names: 1-(4-Aminobenzenesulfonyl)piperidine-3-carboxylic acid, 95%, 1-(4-Aminobenzenesulfonyl)piperidine-3-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 2,5g, 250mg.
1-(4-aminophenyl)sulfonylpiperidine-3-carboxylic acid (CAS 606097-80-7) is a chemical compound with the molecular formula C12H16N2O4S and a molecular weight of 284.33 g/mol. IUPAC name: 1-(4-aminophenyl)sulfonylpiperidine-3-carboxylic acid. InChIKey: GAGYZNBUGHVVSV-UHFFFAOYSA-N.
| Molecular formula | C12H16N2O4S |
|---|---|
| Molecular weight | 284.33 g/mol |
| IUPAC name | 1-(4-aminophenyl)sulfonylpiperidine-3-carboxylic acid |
| InChIKey | GAGYZNBUGHVVSV-UHFFFAOYSA-N |
| SMILES | C1CC(CN(C1)S(=O)(=O)C2=CC=C(C=C2)N)C(=O)O |
Computed by PubChem (NCBI)