CAS 60632-40-8 appears in our catalog under these names: 6-Bromovanillin, 6-Bromovanillin/ 98%, 6-Bromovanillin 98%, 2-Bromo-4-hydroxy-5-methoxybenzaldehyde, 98%, 98%, 6-Bromovanillin, 99.96%. Offered by: TRC, TargetMol, Biosynth, Ambeed, Chemat. Available pack sizes: 100mg, 1g, 2g, 5g, 250mg, 10g, 25g, 100g.
2-bromo-4-hydroxy-5-methoxybenzaldehyde (CAS 60632-40-8) is a chemical compound with the molecular formula C8H7BrO3 and a molecular weight of 231.04 g/mol. IUPAC name: 2-bromo-4-hydroxy-5-methoxybenzaldehyde. InChIKey: FVNRNBGSHCWQPD-UHFFFAOYSA-N.
| Molecular formula | C8H7BrO3 |
|---|---|
| Molecular weight | 231.04 g/mol |
| IUPAC name | 2-bromo-4-hydroxy-5-methoxybenzaldehyde |
| InChIKey | FVNRNBGSHCWQPD-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)C=O)Br)O |
Computed by PubChem (NCBI)