Products 60805-31-4
CAS 60805-31-4 appears in our catalog under these names: Diclofenac Impurity 20, Diclofenac sodium Impurity 55. Offered by: Chemat Brand. Available pack sizes: on request.
(4-chloro-2-hydroxyphenyl)-(4-chlorophenyl)methanone (CAS 60805-31-4) is a chemical compound with the molecular formula C13H8Cl2O2 and a molecular weight of 267.10 g/mol. IUPAC name: (4-chloro-2-hydroxyphenyl)-(4-chlorophenyl)methanone. InChIKey: CNYDAPXBZMSUIT-UHFFFAOYSA-N.
| Molecular formula | C13H8Cl2O2 |
|---|---|
| Molecular weight | 267.10 g/mol |
| IUPAC name | (4-chloro-2-hydroxyphenyl)-(4-chlorophenyl)methanone |
| InChIKey | CNYDAPXBZMSUIT-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)C2=C(C=C(C=C2)Cl)O)Cl |
Computed by PubChem (NCBI)