CAS 60814-30-4 appears in our catalog under these names: 1-(Quinolin-4-yl)ethanone, 1–(Quinolin–4–yl)ethan–1–one. Offered by: Chemat, GLPBio. Available pack sizes: 100mg, 250mg, 1g.
1-quinolin-4-ylethanone (CAS 60814-30-4) is a chemical compound with the molecular formula C11H9NO and a molecular weight of 171.19 g/mol. IUPAC name: 1-quinolin-4-ylethanone. InChIKey: ZHNCGFVDSCRVDH-UHFFFAOYSA-N.
| Molecular formula | C11H9NO |
|---|---|
| Molecular weight | 171.19 g/mol |
| IUPAC name | 1-quinolin-4-ylethanone |
| InChIKey | ZHNCGFVDSCRVDH-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=CC=NC2=CC=CC=C12 |
Computed by PubChem (NCBI)