CAS 608515-43-1 is the registry number for C-(2-Benzyl-thiazol-4-yl)-methylamine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
(2-benzyl-1,3-thiazol-4-yl)methanamine (CAS 608515-43-1) is a chemical compound with the molecular formula C11H12N2S and a molecular weight of 204.29 g/mol. IUPAC name: (2-benzyl-1,3-thiazol-4-yl)methanamine. InChIKey: LHILEUHATDBZOW-UHFFFAOYSA-N.
| Molecular formula | C11H12N2S |
|---|---|
| Molecular weight | 204.29 g/mol |
| IUPAC name | (2-benzyl-1,3-thiazol-4-yl)methanamine |
| InChIKey | LHILEUHATDBZOW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=NC(=CS2)CN |
Computed by PubChem (NCBI)