CAS 60912-82-5 appears in our catalog under these names: alpha-Chloro-2',5'-dihydroxyacetophenone, 2-Chloro-1-(2,5-dihydroxyphenyl)-ethanone, 95%, Norepinephrine Impurity 1, Noradrenaline (Norepinephrine) Impurity 19, 2-Chloro-1-(2,5-dihydroxyphenyl)ethanone 95%. Offered by: TRC, Combi-blocks, Chemat Brand, Ambeed, Fluorochem. Available pack sizes: 500mg, 100mg, 250mg, on request, 25mg, 50mg, 1g.
2-chloro-1-(2,5-dihydroxyphenyl)ethanone (CAS 60912-82-5) is a chemical compound with the molecular formula C8H7ClO3 and a molecular weight of 186.59 g/mol. IUPAC name: 2-chloro-1-(2,5-dihydroxyphenyl)ethanone. InChIKey: LBQJAEBXOIEKLM-UHFFFAOYSA-N.
| Molecular formula | C8H7ClO3 |
|---|---|
| Molecular weight | 186.59 g/mol |
| IUPAC name | 2-chloro-1-(2,5-dihydroxyphenyl)ethanone |
| InChIKey | LBQJAEBXOIEKLM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1O)C(=O)CCl)O |
Computed by PubChem (NCBI)