CAS 60925-76-0 appears in our catalog under these names: (S)-(-)-N-(1-PHENYLETHYL)MALEIMIDE, 97%, (S)-1-(1-Phenylethyl)-1H-pyrrole-2,5-dione, 98%, 98%, (S)-1-(1-Phenylethyl)-1H-pyrrole-2,5-dione, 98%. Offered by: Sigma-Aldrich, Chemat, Fluorochem. Available pack sizes: 1G, 100mg, 250mg.
1-[(1S)-1-phenylethyl]pyrrole-2,5-dione (CAS 60925-76-0) is a chemical compound with the molecular formula C12H11NO2 and a molecular weight of 201.22 g/mol. IUPAC name: 1-[(1S)-1-phenylethyl]pyrrole-2,5-dione. InChIKey: PWZXUQWQRVKGAH-VIFPVBQESA-N.
| Molecular formula | C12H11NO2 |
|---|---|
| Molecular weight | 201.22 g/mol |
| IUPAC name | 1-[(1S)-1-phenylethyl]pyrrole-2,5-dione |
| InChIKey | PWZXUQWQRVKGAH-VIFPVBQESA-N |
| SMILES | C[C@@H](C1=CC=CC=C1)N2C(=O)C=CC2=O |
Computed by PubChem (NCBI)