CAS 6093-68-1 appears in our catalog under these names: 6-Hydroxy Coumarin, 6-Hydroxycoumarin/ 98.5% (existing batch purity), 6-Hydroxycoumarin, 6-Hydroxycoumarin 95%, 6-HYDROXYCOUMARIN, 96%. Offered by: Chemat Brand, TargetMol, Biosynth, Ambeed, Sigma-Aldrich. Available pack sizes: on request, 100mg, 2g, 5g, 10g, 1000g, 25g, 250mg.
6-hydroxychromen-2-one (CAS 6093-68-1) is a chemical compound with the molecular formula C9H6O3 and a molecular weight of 162.14 g/mol. IUPAC name: 6-hydroxychromen-2-one. InChIKey: CJIJXIFQYOPWTF-UHFFFAOYSA-N.
| Molecular formula | C9H6O3 |
|---|---|
| Molecular weight | 162.14 g/mol |
| IUPAC name | 6-hydroxychromen-2-one |
| InChIKey | CJIJXIFQYOPWTF-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=CC(=O)O2)C=C1O |
Computed by PubChem (NCBI)