CAS 60987-21-5 appears in our catalog under these names: 4,5-Dimethoxy-2-methylbenzene-1-sulfonamide, 95%, 4,5-Dimethoxy-2-methylbenzene-1-sulfonamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
4,5-dimethoxy-2-methylbenzenesulfonamide (CAS 60987-21-5) is a chemical compound with the molecular formula C9H13NO4S and a molecular weight of 231.27 g/mol. IUPAC name: 4,5-dimethoxy-2-methylbenzenesulfonamide. InChIKey: ILIDHKYQCNECHQ-UHFFFAOYSA-N.
| Molecular formula | C9H13NO4S |
|---|---|
| Molecular weight | 231.27 g/mol |
| IUPAC name | 4,5-dimethoxy-2-methylbenzenesulfonamide |
| InChIKey | ILIDHKYQCNECHQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1S(=O)(=O)N)OC)OC |
Computed by PubChem (NCBI)