CAS 610278-88-1 appears in our catalog under these names: 3,5-Dichloro-2-nitropyridine 98%, 3,5-Dichloro-2-nitropyridine, 98%, 98%, 3,5-Dichloro-2-nitropyridine, 98%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100mg.
3,5-dichloro-2-nitropyridine (CAS 610278-88-1) is a chemical compound with the molecular formula C5H2Cl2N2O2 and a molecular weight of 192.98 g/mol. IUPAC name: 3,5-dichloro-2-nitropyridine. InChIKey: ACHMQFKFXAKDAH-UHFFFAOYSA-N.
| Molecular formula | C5H2Cl2N2O2 |
|---|---|
| Molecular weight | 192.98 g/mol |
| IUPAC name | 3,5-dichloro-2-nitropyridine |
| InChIKey | ACHMQFKFXAKDAH-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1Cl)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)