Products 61046-59-1
CAS 61046-59-1 is the registry number for (±)-Byakangelicol, 99.29%. Offered by: MedChemExpress. Available pack sizes: 5 mg, 10 mg, 25 mg.
9-[(3,3-dimethyloxiran-2-yl)methoxy]-4-methoxyfuro[3,2-g]chromen-7-one (CAS 61046-59-1) is a chemical compound with the molecular formula C17H16O6 and a molecular weight of 316.30 g/mol. IUPAC name: 9-[(3,3-dimethyloxiran-2-yl)methoxy]-4-methoxyfuro[3,2-g]chromen-7-one. InChIKey: ORBITTMJKIGFNH-UHFFFAOYSA-N.
| Molecular formula | C17H16O6 |
|---|---|
| Molecular weight | 316.30 g/mol |
| IUPAC name | 9-[(3,3-dimethyloxiran-2-yl)methoxy]-4-methoxyfuro[3,2-g]chromen-7-one |
| InChIKey | ORBITTMJKIGFNH-UHFFFAOYSA-N |
| SMILES | CC1(C(O1)COC2=C3C(=C(C4=C2OC(=O)C=C4)OC)C=CO3)C |
Computed by PubChem (NCBI)