CAS 61051-67-0 appears in our catalog under these names: 4-Oxo-3,4-dihydrophthalazine-1-carbohydrazide, 98%, 4-Oxo-3,4-dihydrophthalazine-1-carbohydrazide. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 5g, 2,5g, 250mg.
4-oxo-3H-phthalazine-1-carbohydrazide (CAS 61051-67-0) is a chemical compound with the molecular formula C9H8N4O2 and a molecular weight of 204.19 g/mol. IUPAC name: 4-oxo-3H-phthalazine-1-carbohydrazide. InChIKey: GCZPFBAKQFXQER-UHFFFAOYSA-N.
| Molecular formula | C9H8N4O2 |
|---|---|
| Molecular weight | 204.19 g/mol |
| IUPAC name | 4-oxo-3H-phthalazine-1-carbohydrazide |
| InChIKey | GCZPFBAKQFXQER-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=NNC2=O)C(=O)NN |
Computed by PubChem (NCBI)