CAS 6111-97-3 is the registry number for 4-(4-Nitrophenyl)-1H-1,2,3-triazole. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-(4-nitrophenyl)-2H-triazole (CAS 6111-97-3) is a chemical compound with the molecular formula C8H6N4O2 and a molecular weight of 190.16 g/mol. IUPAC name: 4-(4-nitrophenyl)-2H-triazole. InChIKey: HXIHDBOLXXRPOZ-UHFFFAOYSA-N.
| Molecular formula | C8H6N4O2 |
|---|---|
| Molecular weight | 190.16 g/mol |
| IUPAC name | 4-(4-nitrophenyl)-2H-triazole |
| InChIKey | HXIHDBOLXXRPOZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NNN=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)