Products 61338-39-4
CAS 61338-39-4 is the registry number for 4-Hydroxy-6,8-dimethoxyquinoline-3-carbonitrile. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
6,8-dimethoxy-4-oxo-1H-quinoline-3-carbonitrile (CAS 61338-39-4) is a chemical compound with the molecular formula C12H10N2O3 and a molecular weight of 230.22 g/mol. IUPAC name: 6,8-dimethoxy-4-oxo-1H-quinoline-3-carbonitrile. InChIKey: OBTACCPRZUTOOC-UHFFFAOYSA-N.
| Molecular formula | C12H10N2O3 |
|---|---|
| Molecular weight | 230.22 g/mol |
| IUPAC name | 6,8-dimethoxy-4-oxo-1H-quinoline-3-carbonitrile |
| InChIKey | OBTACCPRZUTOOC-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C(=C1)OC)NC=C(C2=O)C#N |
Computed by PubChem (NCBI)