CAS 61350-60-5 is the registry number for N-Benzyloxycarbonylproline Chloride. Offered by: TRC. Available pack sizes: 1g.
Benzyl (2S)-2-carbonochloridoylpyrrolidine-1-carboxylate (CAS 61350-60-5) is a chemical compound with the molecular formula C13H14ClNO3 and a molecular weight of 267.71 g/mol. IUPAC name: benzyl (2S)-2-carbonochloridoylpyrrolidine-1-carboxylate. InChIKey: IBNYJZJSXDGJNG-NSHDSACASA-N.
| Molecular formula | C13H14ClNO3 |
|---|---|
| Molecular weight | 267.71 g/mol |
| IUPAC name | benzyl (2S)-2-carbonochloridoylpyrrolidine-1-carboxylate |
| InChIKey | IBNYJZJSXDGJNG-NSHDSACASA-N |
| SMILES | C1C[C@H](N(C1)C(=O)OCC2=CC=CC=C2)C(=O)Cl |
Computed by PubChem (NCBI)