CAS 61350-62-7 is the registry number for Benzyl (2R)-2-Chlorocarbonylpyrrolidine-1-carboxylate. Offered by: TRC, Biosynth. Available pack sizes: 250mg.
Benzyl 2-carbonochloridoylpyrrolidine-1-carboxylate (CAS 61350-62-7) is a chemical compound with the molecular formula C13H14ClNO3 and a molecular weight of 267.71 g/mol. IUPAC name: benzyl 2-carbonochloridoylpyrrolidine-1-carboxylate. InChIKey: IBNYJZJSXDGJNG-UHFFFAOYSA-N.
| Molecular formula | C13H14ClNO3 |
|---|---|
| Molecular weight | 267.71 g/mol |
| IUPAC name | benzyl 2-carbonochloridoylpyrrolidine-1-carboxylate |
| InChIKey | IBNYJZJSXDGJNG-UHFFFAOYSA-N |
| SMILES | C1CC(N(C1)C(=O)OCC2=CC=CC=C2)C(=O)Cl |
Computed by PubChem (NCBI)