Products 61383-44-6
CAS 61383-44-6 is the registry number for ethyl 3-(benzo(3,4-d)1,3-dioxolen-5-ylamino)-2-nitriloprop-2-enoate. Offered by: Biosynth. Available pack sizes: 250mg.
Ethyl (E)-3-(1,3-benzodioxol-5-ylamino)-2-cyanoprop-2-enoate (CAS 61383-44-6) is a chemical compound with the molecular formula C13H12N2O4 and a molecular weight of 260.24 g/mol. IUPAC name: ethyl (E)-3-(1,3-benzodioxol-5-ylamino)-2-cyanoprop-2-enoate. InChIKey: IYPIKAMTZQDLFB-VQHVLOKHSA-N.
| Molecular formula | C13H12N2O4 |
|---|---|
| Molecular weight | 260.24 g/mol |
| IUPAC name | ethyl (E)-3-(1,3-benzodioxol-5-ylamino)-2-cyanoprop-2-enoate |
| InChIKey | IYPIKAMTZQDLFB-VQHVLOKHSA-N |
| SMILES | CCOC(=O)/C(=C/NC1=CC2=C(C=C1)OCO2)/C#N |
Computed by PubChem (NCBI)