CAS 61394-51-2 appears in our catalog under these names: 4-Nitroindolin-2-one, 98%, 4-Nitroindolin-2-one 96%, 4-NITROINDOLIN-2-ONE, 96%, 4-Nitroindolin-2-one, 96%, 96%, 4-Nitrooxindole, 96%. Offered by: AmBeed, Fluorochem, Chemat, Combi-blocks. Available pack sizes: 10g, 250mg, 100mg, 1g, 5g, 25g.
4-nitro-1,3-dihydroindol-2-one (CAS 61394-51-2) is a chemical compound with the molecular formula C8H6N2O3 and a molecular weight of 178.14 g/mol. IUPAC name: 4-nitro-1,3-dihydroindol-2-one. InChIKey: ZNBQKWDTXBXIID-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O3 |
|---|---|
| Molecular weight | 178.14 g/mol |
| IUPAC name | 4-nitro-1,3-dihydroindol-2-one |
| InChIKey | ZNBQKWDTXBXIID-UHFFFAOYSA-N |
| SMILES | C1C2=C(C=CC=C2[N+](=O)[O-])NC1=O |
Computed by PubChem (NCBI)