Products 616-72-8
CAS 616-72-8 appears in our catalog under these names: 1,5-Dimethyl-2,4-dinitrobenzene, 95-<97%, 1，5–Dimethyl–2，4–dinitrobenzene, 1,5-dimethyl-2,4-dinitrobenzene, 1，5-Dimethyl-2，4-dinitrobenzene, 98%, 98%, 1,5-Dimethyl-2,4-dinitrobenzene, 98%. Offered by: Hoffman Fine Chemicals, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g, 100g, 100mg, 1g.
1,5-dimethyl-2,4-dinitrobenzene (CAS 616-72-8) is a chemical compound with the molecular formula C8H8N2O4 and a molecular weight of 196.16 g/mol. IUPAC name: 1,5-dimethyl-2,4-dinitrobenzene. InChIKey: FOWXIRIJHSFCRC-UHFFFAOYSA-N.
| Molecular formula | C8H8N2O4 |
|---|---|
| Molecular weight | 196.16 g/mol |
| IUPAC name | 1,5-dimethyl-2,4-dinitrobenzene |
| InChIKey | FOWXIRIJHSFCRC-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1[N+](=O)[O-])[N+](=O)[O-])C |
Computed by PubChem (NCBI)
Synonyms:
4,6-Dinitro-1,3-xylene, 4,6-Dinitro-m-xylene, m-Xylene, 4,6-dinitro-, 1,3-Dimethyl-4,6-dinitrobenzene, Benzene, 1,5-dimethyl-2,4-dinitro-, 4,6-Dinitro-1,3-dimethylbenzene, Benzene, 1,5-dimethyl-2,4-dinitro-(9CI), 1,5-dimethyl-2,4-dinitro-benzene, 4,6-Dinitro-1,3-dimethyl-benzene, 2,4-dimethyl-1,5-dinitrobenzene